C18H21BN2O3 — CID 162471873
N-[4,4,5-trimethyl-5-(pyridin-2-ylmethyl)-1,3,2-dioxaborolan-2-yl]benzamide (PubChem CID 162471873) has the molecular formula C18H21BN2O3 and a molecular weight of 324.19 g/mol. Its IUPAC name is N-[4,4,5-trimethyl-5-(pyridin-2-ylmethyl)-1,3,2-dioxaborolan-2-yl]benzamide.
| Compound Name | N-[4,4,5-trimethyl-5-(pyridin-2-ylmethyl)-1,3,2-dioxaborolan-2-yl]benzamide |
|---|---|
| PubChem CID | 162471873 |
| Molecular Formula | C18H21BN2O3 |
| Molecular Weight | 324.19 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | N-[4,4,5-trimethyl-5-(pyridin-2-ylmethyl)-1,3,2-dioxaborolan-2-yl]benzamide |
| SMILES | CC1(C)OB(NC(=O)c2ccccc2)OC1(C)Cc1ccccn1 |
| InChI | InChI=1S/C18H21BN2O3/c1-17(2)18(3,13-15-11-7-8-12-20-15)24-19(23-17)21-16(22)14-9-5-4-6-10-14/h4-12H,13H2,1-3H3,(H,21,22) |
| InChIKey | CRBIJSXXOKFULL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.19 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|