C11H17BN2O2 — CID 174760251
4,4,5-trimethyl-5-(pyridin-2-ylmethyl)-1,3,2-dioxaborolan-2-amine (PubChem CID 174760251) has the molecular formula C11H17BN2O2 and a molecular weight of 220.08 g/mol. Its IUPAC name is 4,4,5-trimethyl-5-(pyridin-2-ylmethyl)-1,3,2-dioxaborolan-2-amine.
| Compound Name | 4,4,5-trimethyl-5-(pyridin-2-ylmethyl)-1,3,2-dioxaborolan-2-amine |
|---|---|
| PubChem CID | 174760251 |
| Molecular Formula | C11H17BN2O2 |
| Molecular Weight | 220.08 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 4,4,5-trimethyl-5-(pyridin-2-ylmethyl)-1,3,2-dioxaborolan-2-amine |
| SMILES | CC1(C)OB(N)OC1(C)Cc1ccccn1 |
| InChI | InChI=1S/C11H17BN2O2/c1-10(2)11(3,16-12(13)15-10)8-9-6-4-5-7-14-9/h4-7H,8,13H2,1-3H3 |
| InChIKey | ACFGJHXXSNIGKX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.08 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|