C19H20ClN5O4 — CID 162471876
[4-[(6-chloro-5-nitropyrimidin-4-yl)amino]-1-bicyclo[2.2.1]heptanyl] N-benzylcarbamate (PubChem CID 162471876) has the molecular formula C19H20ClN5O4 and a molecular weight of 417.85 g/mol. Its IUPAC name is [4-[(6-chloro-5-nitropyrimidin-4-yl)amino]-1-bicyclo[2.2.1]heptanyl] N-benzylcarbamate.
| Compound Name | [4-[(6-chloro-5-nitropyrimidin-4-yl)amino]-1-bicyclo[2.2.1]heptanyl] N-benzylcarbamate |
|---|---|
| PubChem CID | 162471876 |
| Molecular Formula | C19H20ClN5O4 |
| Molecular Weight | 417.85 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | [4-[(6-chloro-5-nitropyrimidin-4-yl)amino]-1-bicyclo[2.2.1]heptanyl] N-benzylcarbamate |
| SMILES | O=C(NCc1ccccc1)OC12CCC(Nc3ncnc(Cl)c3[N+](=O)[O-])(CC1)C2 |
| InChI | InChI=1S/C19H20ClN5O4/c20-15-14(25(27)28)16(23-12-22-15)24-18-6-8-19(11-18,9-7-18)29-17(26)21-10-13-4-2-1-3-5-13/h1-5,12H,6-11H2,(H,21,26)(H,22,23,24) |
| InChIKey | GATJWKXOHGCOJM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.85 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|