C19H36N2OY-2 — CID 162471915
[4-(1-tert-butylpiperidin-4-yl)piperidin-1-yl]methanone;2-methylpropane;yttrium (PubChem CID 162471915) has the molecular formula C19H36N2OY-2 and a molecular weight of 397.42 g/mol. Its IUPAC name is [4-(1-tert-butylpiperidin-4-yl)piperidin-1-yl]methanone;2-methylpropane;yttrium.
| Compound Name | [4-(1-tert-butylpiperidin-4-yl)piperidin-1-yl]methanone;2-methylpropane;yttrium |
|---|---|
| PubChem CID | 162471915 |
| Molecular Formula | C19H36N2OY-2 |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | [4-(1-tert-butylpiperidin-4-yl)piperidin-1-yl]methanone;2-methylpropane;yttrium |
| SMILES | CC(C)(C)N1CCC(C2CCN([C-]=O)CC2)CC1.C[C-](C)C.[Y] |
| InChI | InChI=1S/C15H27N2O.C4H9.Y/c1-15(2,3)17-10-6-14(7-11-17)13-4-8-16(12-18)9-5-13;1-4(2)3;/h13-14H,4-11H2,1-3H3;1-3H3;/q2*-1; |
| InChIKey | NSWXTMWWINNDBA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|