C26H50N4O2 — CID 143193564
N-[6-[formyl-(1,2,2,3-tetramethylpiperidin-4-yl)amino]hexyl]-N-(1,2,2,3-tetramethylpiperidin-4-yl)formamide (PubChem CID 143193564) has the molecular formula C26H50N4O2 and a molecular weight of 450.71 g/mol. Its IUPAC name is N-[6-[formyl-(1,2,2,3-tetramethylpiperidin-4-yl)amino]hexyl]-N-(1,2,2,3-tetramethylpiperidin-4-yl)formamide.
| Compound Name | N-[6-[formyl-(1,2,2,3-tetramethylpiperidin-4-yl)amino]hexyl]-N-(1,2,2,3-tetramethylpiperidin-4-yl)formamide |
|---|---|
| PubChem CID | 143193564 |
| Molecular Formula | C26H50N4O2 |
| Molecular Weight | 450.71 g/mol |
| Exact Mass | 450.39 |
| IUPAC Name | N-[6-[formyl-(1,2,2,3-tetramethylpiperidin-4-yl)amino]hexyl]-N-(1,2,2,3-tetramethylpiperidin-4-yl)formamide |
| SMILES | CC1C(N(C=O)CCCCCCN(C=O)C2CCN(C)C(C)(C)C2C)CCN(C)C1(C)C |
| InChI | InChI=1S/C26H50N4O2/c1-21-23(13-17-27(7)25(21,3)4)29(19-31)15-11-9-10-12-16-30(20-32)24-14-18-28(8)26(5,6)22(24)2/h19-24H,9-18H2,1-8H3 |
| InChIKey | UICGPPIVMUUEMP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.71 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|