C25H48N4O2 — CID 91605976
N-[3-[formyl-(2,2,4,6,6-pentamethylpiperidin-1-yl)amino]propyl]-N-(2,2,4,6,6-pentamethylpiperidin-1-yl)formamide (PubChem CID 91605976) has the molecular formula C25H48N4O2 and a molecular weight of 436.69 g/mol. Its IUPAC name is N-[3-[formyl-(2,2,4,6,6-pentamethylpiperidin-1-yl)amino]propyl]-N-(2,2,4,6,6-pentamethylpiperidin-1-yl)formamide.
| Compound Name | N-[3-[formyl-(2,2,4,6,6-pentamethylpiperidin-1-yl)amino]propyl]-N-(2,2,4,6,6-pentamethylpiperidin-1-yl)formamide |
|---|---|
| PubChem CID | 91605976 |
| Molecular Formula | C25H48N4O2 |
| Molecular Weight | 436.69 g/mol |
| Exact Mass | 436.38 |
| IUPAC Name | N-[3-[formyl-(2,2,4,6,6-pentamethylpiperidin-1-yl)amino]propyl]-N-(2,2,4,6,6-pentamethylpiperidin-1-yl)formamide |
| SMILES | CC1CC(C)(C)N(N(C=O)CCCN(C=O)N2C(C)(C)CC(C)CC2(C)C)C(C)(C)C1 |
| InChI | InChI=1S/C25H48N4O2/c1-20-14-22(3,4)28(23(5,6)15-20)26(18-30)12-11-13-27(19-31)29-24(7,8)16-21(2)17-25(29,9)10/h18-21H,11-17H2,1-10H3 |
| InChIKey | MPAPKKSXRCPWSS-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.69 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|