C28H54N4O2 — CID 90945994
N-[6-[formyl-(2,2,4,6,6-pentamethylpiperidin-1-yl)amino]hexyl]-N-(2,2,4,6,6-pentamethylpiperidin-1-yl)formamide (PubChem CID 90945994) has the molecular formula C28H54N4O2 and a molecular weight of 478.77 g/mol. Its IUPAC name is N-[6-[formyl-(2,2,4,6,6-pentamethylpiperidin-1-yl)amino]hexyl]-N-(2,2,4,6,6-pentamethylpiperidin-1-yl)formamide.
| Compound Name | N-[6-[formyl-(2,2,4,6,6-pentamethylpiperidin-1-yl)amino]hexyl]-N-(2,2,4,6,6-pentamethylpiperidin-1-yl)formamide |
|---|---|
| PubChem CID | 90945994 |
| Molecular Formula | C28H54N4O2 |
| Molecular Weight | 478.77 g/mol |
| Exact Mass | 478.42 |
| IUPAC Name | N-[6-[formyl-(2,2,4,6,6-pentamethylpiperidin-1-yl)amino]hexyl]-N-(2,2,4,6,6-pentamethylpiperidin-1-yl)formamide |
| SMILES | CC1CC(C)(C)N(N(C=O)CCCCCCN(C=O)N2C(C)(C)CC(C)CC2(C)C)C(C)(C)C1 |
| InChI | InChI=1S/C28H54N4O2/c1-23-17-25(3,4)31(26(5,6)18-23)29(21-33)15-13-11-12-14-16-30(22-34)32-27(7,8)19-24(2)20-28(32,9)10/h21-24H,11-20H2,1-10H3 |
| InChIKey | QZHWKZMJWOKSPA-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.77 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|