C24H46N4O2 — CID 90916263
N-[2-[formyl-(2,2,4,6,6-pentamethylpiperidin-1-yl)amino]ethyl]-N-(2,2,4,6,6-pentamethylpiperidin-1-yl)formamide (PubChem CID 90916263) has the molecular formula C24H46N4O2 and a molecular weight of 422.66 g/mol. Its IUPAC name is N-[2-[formyl-(2,2,4,6,6-pentamethylpiperidin-1-yl)amino]ethyl]-N-(2,2,4,6,6-pentamethylpiperidin-1-yl)formamide.
| Compound Name | N-[2-[formyl-(2,2,4,6,6-pentamethylpiperidin-1-yl)amino]ethyl]-N-(2,2,4,6,6-pentamethylpiperidin-1-yl)formamide |
|---|---|
| PubChem CID | 90916263 |
| Molecular Formula | C24H46N4O2 |
| Molecular Weight | 422.66 g/mol |
| Exact Mass | 422.36 |
| IUPAC Name | N-[2-[formyl-(2,2,4,6,6-pentamethylpiperidin-1-yl)amino]ethyl]-N-(2,2,4,6,6-pentamethylpiperidin-1-yl)formamide |
| SMILES | CC1CC(C)(C)N(N(C=O)CCN(C=O)N2C(C)(C)CC(C)CC2(C)C)C(C)(C)C1 |
| InChI | InChI=1S/C24H46N4O2/c1-19-13-21(3,4)27(22(5,6)14-19)25(17-29)11-12-26(18-30)28-23(7,8)15-20(2)16-24(28,9)10/h17-20H,11-16H2,1-10H3 |
| InChIKey | SESSPQSCDMKVHQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.66 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|