C29H56N4O2 — CID 91497108
N-[6-[(1-ethyl-2,2,6,6-tetramethylpiperidin-4-yl)-formylamino]hexyl]-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)formamide (PubChem CID 91497108) has the molecular formula C29H56N4O2 and a molecular weight of 492.79 g/mol. Its IUPAC name is N-[6-[(1-ethyl-2,2,6,6-tetramethylpiperidin-4-yl)-formylamino]hexyl]-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)formamide.
| Compound Name | N-[6-[(1-ethyl-2,2,6,6-tetramethylpiperidin-4-yl)-formylamino]hexyl]-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)formamide |
|---|---|
| PubChem CID | 91497108 |
| Molecular Formula | C29H56N4O2 |
| Molecular Weight | 492.79 g/mol |
| Exact Mass | 492.44 |
| IUPAC Name | N-[6-[(1-ethyl-2,2,6,6-tetramethylpiperidin-4-yl)-formylamino]hexyl]-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)formamide |
| SMILES | CCN1C(C)(C)CC(N(C=O)CCCCCCN(C=O)C2CC(C)(C)N(C)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C29H56N4O2/c1-11-33-28(6,7)20-25(21-29(33,8)9)32(23-35)17-15-13-12-14-16-31(22-34)24-18-26(2,3)30(10)27(4,5)19-24/h22-25H,11-21H2,1-10H3 |
| InChIKey | IVXHVTKYBKEEQG-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.79 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|