C19H37N3O — CID 14419062
N,N-bis(2,2,6,6-tetramethylpiperidin-4-yl)formamide (PubChem CID 14419062) has the molecular formula C19H37N3O and a molecular weight of 323.52 g/mol. Its IUPAC name is N,N-bis(2,2,6,6-tetramethylpiperidin-4-yl)formamide.
| Compound Name | N,N-bis(2,2,6,6-tetramethylpiperidin-4-yl)formamide |
|---|---|
| PubChem CID | 14419062 |
| Molecular Formula | C19H37N3O |
| Molecular Weight | 323.52 g/mol |
| Exact Mass | 323.29 |
| IUPAC Name | N,N-bis(2,2,6,6-tetramethylpiperidin-4-yl)formamide |
| SMILES | CC1(C)CC(N(C=O)C2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C19H37N3O/c1-16(2)9-14(10-17(3,4)20-16)22(13-23)15-11-18(5,6)21-19(7,8)12-15/h13-15,20-21H,9-12H2,1-8H3 |
| InChIKey | BMYIDSFEEKBQGX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|