C14H30N2 — CID 90292225
N-tert-butyl-N,2,2,6,6-pentamethylpiperidin-4-amine (PubChem CID 90292225) has the molecular formula C14H30N2 and a molecular weight of 226.41 g/mol. Its IUPAC name is N-tert-butyl-N,2,2,6,6-pentamethylpiperidin-4-amine.
| Compound Name | N-tert-butyl-N,2,2,6,6-pentamethylpiperidin-4-amine |
|---|---|
| PubChem CID | 90292225 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | N-tert-butyl-N,2,2,6,6-pentamethylpiperidin-4-amine |
| SMILES | CN(C1CC(C)(C)NC(C)(C)C1)C(C)(C)C |
| InChI | InChI=1S/C14H30N2/c1-12(2,3)16(8)11-9-13(4,5)15-14(6,7)10-11/h11,15H,9-10H2,1-8H3 |
| InChIKey | HXHJOJOMPUSZPT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |