C23H44N8 — CID 70877997
2-N,4-N-dimethyl-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 70877997) has the molecular formula C23H44N8 and a molecular weight of 432.66 g/mol. Its IUPAC name is 2-N,4-N-dimethyl-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N-dimethyl-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 70877997 |
| Molecular Formula | C23H44N8 |
| Molecular Weight | 432.66 g/mol |
| Exact Mass | 432.37 |
| IUPAC Name | 2-N,4-N-dimethyl-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CN(c1nc(N)nc(N(C)C2CC(C)(C)NC(C)(C)C2)n1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C23H44N8/c1-20(2)11-15(12-21(3,4)28-20)30(9)18-25-17(24)26-19(27-18)31(10)16-13-22(5,6)29-23(7,8)14-16/h15-16,28-29H,11-14H2,1-10H3,(H2,24,25,26,27) |
| InChIKey | YJSYQHDDFBJDGI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.66 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |