C14H27N7 — CID 143175629
2-N-ethyl-2-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 143175629) has the molecular formula C14H27N7 and a molecular weight of 293.42 g/mol. Its IUPAC name is 2-N-ethyl-2-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-ethyl-2-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 143175629 |
| Molecular Formula | C14H27N7 |
| Molecular Weight | 293.42 g/mol |
| Exact Mass | 293.23 |
| IUPAC Name | 2-N-ethyl-2-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN(c1nc(N)nc(N)n1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C14H27N7/c1-6-21(12-18-10(15)17-11(16)19-12)9-7-13(2,3)20-14(4,5)8-9/h9,20H,6-8H2,1-5H3,(H4,15,16,17,18,19) |
| InChIKey | WNUFSWQWSOEAPB-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.42 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |