C23H43N7 — CID 142084198
2-N,6-dimethyl-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 142084198) has the molecular formula C23H43N7 and a molecular weight of 417.65 g/mol. Its IUPAC name is 2-N,6-dimethyl-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,6-dimethyl-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 142084198 |
| Molecular Formula | C23H43N7 |
| Molecular Weight | 417.65 g/mol |
| Exact Mass | 417.36 |
| IUPAC Name | 2-N,6-dimethyl-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1nc(NC2CC(C)(C)NC(C)(C)C2)nc(N(C)C2CC(C)(C)NC(C)(C)C2)n1 |
| InChI | InChI=1S/C23H43N7/c1-15-24-18(26-16-11-20(2,3)28-21(4,5)12-16)27-19(25-15)30(10)17-13-22(6,7)29-23(8,9)14-17/h16-17,28-29H,11-14H2,1-10H3,(H,24,25,26,27) |
| InChIKey | MQLVBCVJEJYTON-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 78.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.65 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |