C17H32N6 — CID 137402856
2-N,2-N,4-N,4-N-tetramethyl-6-[(2,2,6,6-tetramethylpiperidin-4-yl)methyl]-1,3,5-triazine-2,4-diamine (PubChem CID 137402856) has the molecular formula C17H32N6 and a molecular weight of 320.49 g/mol. Its IUPAC name is 2-N,2-N,4-N,4-N-tetramethyl-6-[(2,2,6,6-tetramethylpiperidin-4-yl)methyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N,4-N,4-N-tetramethyl-6-[(2,2,6,6-tetramethylpiperidin-4-yl)methyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 137402856 |
| Molecular Formula | C17H32N6 |
| Molecular Weight | 320.49 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | 2-N,2-N,4-N,4-N-tetramethyl-6-[(2,2,6,6-tetramethylpiperidin-4-yl)methyl]-1,3,5-triazine-2,4-diamine |
| SMILES | CN(C)c1nc(CC2CC(C)(C)NC(C)(C)C2)nc(N(C)C)n1 |
| InChI | InChI=1S/C17H32N6/c1-16(2)10-12(11-17(3,4)21-16)9-13-18-14(22(5)6)20-15(19-13)23(7)8/h12,21H,9-11H2,1-8H3 |
| InChIKey | WSBZZMKEAUHIIP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.49 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |