C31H60N8 — CID 54147043
2-N,2-N-dipropyl-4-N,6-N-bis[2-(2,2,6,6-tetramethylpiperidin-4-yl)ethyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 54147043) has the molecular formula C31H60N8 and a molecular weight of 544.88 g/mol. Its IUPAC name is 2-N,2-N-dipropyl-4-N,6-N-bis[2-(2,2,6,6-tetramethylpiperidin-4-yl)ethyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N-dipropyl-4-N,6-N-bis[2-(2,2,6,6-tetramethylpiperidin-4-yl)ethyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 54147043 |
| Molecular Formula | C31H60N8 |
| Molecular Weight | 544.88 g/mol |
| Exact Mass | 544.49 |
| IUPAC Name | 2-N,2-N-dipropyl-4-N,6-N-bis[2-(2,2,6,6-tetramethylpiperidin-4-yl)ethyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCN(CCC)c1nc(NCCC2CC(C)(C)NC(C)(C)C2)nc(NCCC2CC(C)(C)NC(C)(C)C2)n1 |
| InChI | InChI=1S/C31H60N8/c1-11-17-39(18-12-2)27-35-25(32-15-13-23-19-28(3,4)37-29(5,6)20-23)34-26(36-27)33-16-14-24-21-30(7,8)38-31(9,10)22-24/h23-24,37-38H,11-22H2,1-10H3,(H2,32,33,34,35,36) |
| InChIKey | OFCUAVCXXSATLQ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.88 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |