C27H48N8 — CID 54396012
4-N,6-N-bis(prop-2-enyl)-2-N,2-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 54396012) has the molecular formula C27H48N8 and a molecular weight of 484.74 g/mol. Its IUPAC name is 4-N,6-N-bis(prop-2-enyl)-2-N,2-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N,6-N-bis(prop-2-enyl)-2-N,2-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 54396012 |
| Molecular Formula | C27H48N8 |
| Molecular Weight | 484.74 g/mol |
| Exact Mass | 484.40 |
| IUPAC Name | 4-N,6-N-bis(prop-2-enyl)-2-N,2-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | C=CCNc1nc(NCC=C)nc(N(C2CC(C)(C)NC(C)(C)C2)C2CC(C)(C)NC(C)(C)C2)n1 |
| InChI | InChI=1S/C27H48N8/c1-11-13-28-21-30-22(29-14-12-2)32-23(31-21)35(19-15-24(3,4)33-25(5,6)16-19)20-17-26(7,8)34-27(9,10)18-20/h11-12,19-20,33-34H,1-2,13-18H2,3-10H3,(H2,28,29,30,31,32) |
| InChIKey | VJZNVDYKUYZDMZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.74 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|