C14H26N6 — CID 80847684
4-N-(2-cyclopropylethyl)-2-N,2-N,6-N-triethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 80847684) has the molecular formula C14H26N6 and a molecular weight of 278.40 g/mol. Its IUPAC name is 4-N-(2-cyclopropylethyl)-2-N,2-N,6-N-triethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-(2-cyclopropylethyl)-2-N,2-N,6-N-triethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80847684 |
| Molecular Formula | C14H26N6 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 4-N-(2-cyclopropylethyl)-2-N,2-N,6-N-triethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCNc1nc(NCCC2CC2)nc(N(CC)CC)n1 |
| InChI | InChI=1S/C14H26N6/c1-4-15-12-17-13(16-10-9-11-7-8-11)19-14(18-12)20(5-2)6-3/h11H,4-10H2,1-3H3,(H2,15,16,17,18,19) |
| InChIKey | UUZRQKURIZDCMF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |