C23H49N3Si — CID 59045596
N-(3-dimethylsilylpropyl)-2,2,6,6-tetramethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)piperidin-4-amine (PubChem CID 59045596) has the molecular formula C23H49N3Si and a molecular weight of 395.75 g/mol. Its IUPAC name is N-(3-dimethylsilylpropyl)-2,2,6,6-tetramethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)piperidin-4-amine.
| Compound Name | N-(3-dimethylsilylpropyl)-2,2,6,6-tetramethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 59045596 |
| Molecular Formula | C23H49N3Si |
| Molecular Weight | 395.75 g/mol |
| Exact Mass | 395.37 |
| IUPAC Name | N-(3-dimethylsilylpropyl)-2,2,6,6-tetramethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)piperidin-4-amine |
| SMILES | C[SiH](C)CCCN(C1CC(C)(C)NC(C)(C)C1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C23H49N3Si/c1-20(2)14-18(15-21(3,4)24-20)26(12-11-13-27(9)10)19-16-22(5,6)25-23(7,8)17-19/h18-19,24-25,27H,11-17H2,1-10H3 |
| InChIKey | FSBLMGHEAYCRFB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.75 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|