C27H52N4O2 — CID 59873148
N-[6-[formyl-(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]hexyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)formamide (PubChem CID 59873148) has the molecular formula C27H52N4O2 and a molecular weight of 464.74 g/mol. Its IUPAC name is N-[6-[formyl-(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]hexyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)formamide.
| Compound Name | N-[6-[formyl-(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]hexyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)formamide |
|---|---|
| PubChem CID | 59873148 |
| Molecular Formula | C27H52N4O2 |
| Molecular Weight | 464.74 g/mol |
| Exact Mass | 464.41 |
| IUPAC Name | N-[6-[formyl-(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]hexyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)formamide |
| SMILES | CN1C(C)(C)CC(N(C=O)CCCCCCN(C=O)C2CC(C)(C)NC(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C27H52N4O2/c1-24(2)16-22(17-25(3,4)28-24)30(20-32)14-12-10-11-13-15-31(21-33)23-18-26(5,6)29(9)27(7,8)19-23/h20-23,28H,10-19H2,1-9H3 |
| InChIKey | XACOWSLVANBBEH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.74 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|