C29H29N — CID 162474300
10,20-ditert-butyl-15-azapentacyclo[12.7.1.02,7.08,13.018,22]docosa-1(22),2,4,6,8(13),9,11,14,16,18,20-undecaene (PubChem CID 162474300) has the molecular formula C29H29N and a molecular weight of 391.56 g/mol. Its IUPAC name is 10,20-ditert-butyl-15-azapentacyclo[12.7.1.02,7.08,13.018,22]docosa-1(22),2,4,6,8(13),9,11,14,16,18,20-undecaene.
| Compound Name | 10,20-ditert-butyl-15-azapentacyclo[12.7.1.02,7.08,13.018,22]docosa-1(22),2,4,6,8(13),9,11,14,16,18,20-undecaene |
|---|---|
| PubChem CID | 162474300 |
| Molecular Formula | C29H29N |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 10,20-ditert-butyl-15-azapentacyclo[12.7.1.02,7.08,13.018,22]docosa-1(22),2,4,6,8(13),9,11,14,16,18,20-undecaene |
| SMILES | CC(C)(C)c1ccc2c(c1)-c1ccccc1-c1cc(C(C)(C)C)cc3ccnc-2c13 |
| InChI | InChI=1S/C29H29N/c1-28(2,3)19-11-12-23-24(16-19)21-9-7-8-10-22(21)25-17-20(29(4,5)6)15-18-13-14-30-27(23)26(18)25/h7-17H,1-6H3 |
| InChIKey | NCJNQKSULOMUHQ-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |