About CID 162474308
CID 162474308 (PubChem CID 162474308) has the molecular formula C41H50IrNO2-
and a molecular weight of 781.07 g/mol.
Molecular Properties
| Compound Name | CID 162474308 |
| PubChem CID | 162474308 |
| Molecular Formula | C41H50IrNO2- |
| Molecular Weight | 781.07 g/mol |
| Exact Mass | 781.35 |
| IUPAC Name | — |
| SMILES | CCC(C)C(=O)/C=C(\O)C(C)CC.Cc1c[c-]c2c(c1)-c1cc(CC(C)(C)C)ccc1-c1cc(C(C)C)cc3ccnc-2c13.[Ir] |
| InChI | InChI=1S/C30H30N.C11H20O2.Ir/c1-18(2)22-15-21-11-12-31-29-24-9-7-19(3)13-25(24)26-14-20(17-30(4,5)6)8-10-23(26)27(16-22)28(21)29;1-5-8(3)10(12)7-11(13)9(4)6-2;/h7-8,10-16,18H,17H2,1-6H3;7-9,12H,5-6H2,1-4H3;/q-1;;/b;10-7-; |
| InChIKey | IFCAKEGIYKTWAA-YAJOTRLJSA-N |
| XLogP | 11.46 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 781.07 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 162474308 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162474308?
The IUPAC name of CID 162474308 (CID 162474308) is not available.
What is the SMILES notation for CID 162474308?
The canonical SMILES for CID 162474308 is CCC(C)C(=O)/C=C(\O)C(C)CC.Cc1c[c-]c2c(c1)-c1cc(CC(C)(C)C)ccc1-c1cc(C(C)C)cc3ccnc-2c13.[Ir].
What is the InChIKey of CID 162474308?
The InChIKey is IFCAKEGIYKTWAA-YAJOTRLJSA-N. The full InChI is InChI=1S/C30H30N.C11H20O2.Ir/c1-18(2)22-15-21-11-12-31-29-24-9-7-19(3)13-25(24)26-14-20(17-30(4,5)6)8-10-23(26)27(16-22)28(21)29;1-5-8(3)10(12)7-11(13)9(4)6-2;/h7-8,10-16,18H,17H2,1-6H3;7-9,12H,5-6H2,1-4H3;/q-1;;/b;10-7-;.
What are the key properties of CID 162474308?
CID 162474308 has a molecular weight of 781.07 g/mol, XLogP of 11.46, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162474308 is sourced from PubChem (CID 162474308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).