About CID 162474267
CID 162474267 (PubChem CID 162474267) has the molecular formula C36H40IrNO2-
and a molecular weight of 710.94 g/mol.
Molecular Properties
| Compound Name | CID 162474267 |
| PubChem CID | 162474267 |
| Molecular Formula | C36H40IrNO2- |
| Molecular Weight | 710.94 g/mol |
| Exact Mass | 711.27 |
| IUPAC Name | — |
| SMILES | CC(C)CC(=O)/C=C(\O)CC(C)C.Cc1ccc2c(c1)-c1cc(C(C)C)c[c-]c1-c1nccc3cccc-2c13.[Ir] |
| InChI | InChI=1S/C25H20N.C11H20O2.Ir/c1-15(2)18-8-10-21-23(14-18)22-13-16(3)7-9-19(22)20-6-4-5-17-11-12-26-25(21)24(17)20;1-8(2)5-10(12)7-11(13)6-9(3)4;/h4-9,11-15H,1-3H3;7-9,12H,5-6H2,1-4H3;/q-1;;/b;10-7-; |
| InChIKey | WBBMWSFYAHPODE-YAJOTRLJSA-N |
| XLogP | 9.87 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 710.94 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 162474267 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162474267?
The IUPAC name of CID 162474267 (CID 162474267) is not available.
What is the SMILES notation for CID 162474267?
The canonical SMILES for CID 162474267 is CC(C)CC(=O)/C=C(\O)CC(C)C.Cc1ccc2c(c1)-c1cc(C(C)C)c[c-]c1-c1nccc3cccc-2c13.[Ir].
What is the InChIKey of CID 162474267?
The InChIKey is WBBMWSFYAHPODE-YAJOTRLJSA-N. The full InChI is InChI=1S/C25H20N.C11H20O2.Ir/c1-15(2)18-8-10-21-23(14-18)22-13-16(3)7-9-19(22)20-6-4-5-17-11-12-26-25(21)24(17)20;1-8(2)5-10(12)7-11(13)6-9(3)4;/h4-9,11-15H,1-3H3;7-9,12H,5-6H2,1-4H3;/q-1;;/b;10-7-;.
What are the key properties of CID 162474267?
CID 162474267 has a molecular weight of 710.94 g/mol, XLogP of 9.87, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162474267 is sourced from PubChem (CID 162474267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).