C41H42IrNO2S- — CID 162485878
CID 162485878 (PubChem CID 162485878) has the molecular formula C41H42IrNO2S- and a molecular weight of 805.08 g/mol.
| Compound Name | CID 162485878 |
|---|---|
| PubChem CID | 162485878 |
| Molecular Formula | C41H42IrNO2S- |
| Molecular Weight | 805.08 g/mol |
| Exact Mass | 805.26 |
| IUPAC Name | — |
| SMILES | CC(C)CC(=O)/C=C(\O)CC(C)C.CC(C)c1ccc2c(-c3[c-]cc4c(c3)-c3ccccc3-c3ccccc3S4)nccc2c1.[Ir] |
| InChI | InChI=1S/C30H22NS.C11H20O2.Ir/c1-19(2)20-11-13-23-21(17-20)15-16-31-30(23)22-12-14-29-27(18-22)25-8-4-3-7-24(25)26-9-5-6-10-28(26)32-29;1-8(2)5-10(12)7-11(13)6-9(3)4;/h3-11,13-19H,1-2H3;7-9,12H,5-6H2,1-4H3;/q-1;;/b;10-7-; |
| InChIKey | SKOQVUFNPXZBIW-YAJOTRLJSA-N |
| XLogP | 11.71 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.08 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|