About CID 162474247
CID 162474247 (PubChem CID 162474247) has the molecular formula C36H40IrNO2-
and a molecular weight of 710.94 g/mol.
Molecular Properties
| Compound Name | CID 162474247 |
| PubChem CID | 162474247 |
| Molecular Formula | C36H40IrNO2- |
| Molecular Weight | 710.94 g/mol |
| Exact Mass | 711.27 |
| IUPAC Name | — |
| SMILES | CC(C)CC(=O)/C=C(\O)CC(C)C.CC(C)Cc1cnc2c3c(cccc13)-c1ccccc1-c1ccc[c-]c1-2.[Ir] |
| InChI | InChI=1S/C25H20N.C11H20O2.Ir/c1-16(2)14-17-15-26-25-23-11-6-5-10-21(23)19-8-3-4-9-20(19)22-13-7-12-18(17)24(22)25;1-8(2)5-10(12)7-11(13)6-9(3)4;/h3-10,12-13,15-16H,14H2,1-2H3;7-9,12H,5-6H2,1-4H3;/q-1;;/b;10-7-; |
| InChIKey | MUQUNXTZYNEADN-YAJOTRLJSA-N |
| XLogP | 9.63 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 710.94 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 162474247 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162474247?
The IUPAC name of CID 162474247 (CID 162474247) is not available.
What is the SMILES notation for CID 162474247?
The canonical SMILES for CID 162474247 is CC(C)CC(=O)/C=C(\O)CC(C)C.CC(C)Cc1cnc2c3c(cccc13)-c1ccccc1-c1ccc[c-]c1-2.[Ir].
What is the InChIKey of CID 162474247?
The InChIKey is MUQUNXTZYNEADN-YAJOTRLJSA-N. The full InChI is InChI=1S/C25H20N.C11H20O2.Ir/c1-16(2)14-17-15-26-25-23-11-6-5-10-21(23)19-8-3-4-9-20(19)22-13-7-12-18(17)24(22)25;1-8(2)5-10(12)7-11(13)6-9(3)4;/h3-10,12-13,15-16H,14H2,1-2H3;7-9,12H,5-6H2,1-4H3;/q-1;;/b;10-7-;.
What are the key properties of CID 162474247?
CID 162474247 has a molecular weight of 710.94 g/mol, XLogP of 9.63, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162474247 is sourced from PubChem (CID 162474247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).