C36H40IrNO2- — CID 162474247
CID 162474247 (PubChem CID 162474247) has the molecular formula C36H40IrNO2- and a molecular weight of 710.94 g/mol.
| Compound Name | CID 162474247 |
|---|---|
| PubChem CID | 162474247 |
| Molecular Formula | C36H40IrNO2- |
| Molecular Weight | 710.94 g/mol |
| Exact Mass | 711.27 |
| IUPAC Name | — |
| SMILES | CC(C)CC(=O)/C=C(\O)CC(C)C.CC(C)Cc1cnc2c3c(cccc13)-c1ccccc1-c1ccc[c-]c1-2.[Ir] |
| InChI | InChI=1S/C25H20N.C11H20O2.Ir/c1-16(2)14-17-15-26-25-23-11-6-5-10-21(23)19-8-3-4-9-20(19)22-13-7-12-18(17)24(22)25;1-8(2)5-10(12)7-11(13)6-9(3)4;/h3-10,12-13,15-16H,14H2,1-2H3;7-9,12H,5-6H2,1-4H3;/q-1;;/b;10-7-; |
| InChIKey | MUQUNXTZYNEADN-YAJOTRLJSA-N |
| XLogP | 9.63 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.94 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|