C32H40IrO2-2 — CID 172504440
(Z)-6-hydroxy-2,8-dimethylnon-5-en-4-one;iridium;2-(3-methylbenzene-6-id-1-yl)-5-(2-methylpropyl)-1H-naphthalen-1-ide (PubChem CID 172504440) has the molecular formula C32H40IrO2-2 and a molecular weight of 648.89 g/mol. Its IUPAC name is (Z)-6-hydroxy-2,8-dimethylnon-5-en-4-one;iridium;2-(3-methylbenzene-6-id-1-yl)-5-(2-methylpropyl)-1H-naphthalen-1-ide.
| Compound Name | (Z)-6-hydroxy-2,8-dimethylnon-5-en-4-one;iridium;2-(3-methylbenzene-6-id-1-yl)-5-(2-methylpropyl)-1H-naphthalen-1-ide |
|---|---|
| PubChem CID | 172504440 |
| Molecular Formula | C32H40IrO2-2 |
| Molecular Weight | 648.89 g/mol |
| Exact Mass | 649.27 |
| IUPAC Name | (Z)-6-hydroxy-2,8-dimethylnon-5-en-4-one;iridium;2-(3-methylbenzene-6-id-1-yl)-5-(2-methylpropyl)-1H-naphthalen-1-ide |
| SMILES | CC(C)CC(=O)/C=C(\O)CC(C)C.Cc1cc[c-]c(-c2[c-]c3cccc(CC(C)C)c3cc2)c1.[Ir] |
| InChI | InChI=1S/C21H20.C11H20O2.Ir/c1-15(2)12-19-8-5-9-20-14-18(10-11-21(19)20)17-7-4-6-16(3)13-17;1-8(2)5-10(12)7-11(13)6-9(3)4;/h4-6,8-11,13,15H,12H2,1-3H3;7-9,12H,5-6H2,1-4H3;/q-2;;/b;10-7-; |
| InChIKey | PANAGCUOODQWNZ-YAJOTRLJSA-N |
| XLogP | 8.70 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.89 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|