C35H36IrNO3- — CID 161090743
CID 161090743 (PubChem CID 161090743) has the molecular formula C35H36IrNO3- and a molecular weight of 710.89 g/mol.
| Compound Name | CID 161090743 |
|---|---|
| PubChem CID | 161090743 |
| Molecular Formula | C35H36IrNO3- |
| Molecular Weight | 710.89 g/mol |
| Exact Mass | 711.23 |
| IUPAC Name | — |
| SMILES | CC(C)CC(=O)C=C(O)CC(C)C.Cc1cccc(-c2cnc3c(c2)-c2ccccc2Oc2ccc[c-]c2-3)c1.[Ir] |
| InChI | InChI=1S/C24H16NO.C11H20O2.Ir/c1-16-7-6-8-17(13-16)18-14-21-19-9-2-4-11-22(19)26-23-12-5-3-10-20(23)24(21)25-15-18;1-8(2)5-10(12)7-11(13)6-9(3)4;/h2-9,11-15H,1H3;7-9,12H,5-6H2,1-4H3;/q-1;; |
| InChIKey | UUXDNPCQDWALSY-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.89 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|