C25H15F3IrNO2S2- — CID 162475881
1-(3H-1-benzothiophen-3-id-2-yl)isoquinoline;iridium;(Z)-4,4,4-trifluoro-3-hydroxy-1-thiophen-2-ylbut-2-en-1-one (PubChem CID 162475881) has the molecular formula C25H15F3IrNO2S2- and a molecular weight of 674.75 g/mol. Its IUPAC name is 1-(3H-1-benzothiophen-3-id-2-yl)isoquinoline;iridium;(Z)-4,4,4-trifluoro-3-hydroxy-1-thiophen-2-ylbut-2-en-1-one.
| Compound Name | 1-(3H-1-benzothiophen-3-id-2-yl)isoquinoline;iridium;(Z)-4,4,4-trifluoro-3-hydroxy-1-thiophen-2-ylbut-2-en-1-one |
|---|---|
| PubChem CID | 162475881 |
| Molecular Formula | C25H15F3IrNO2S2- |
| Molecular Weight | 674.75 g/mol |
| Exact Mass | 675.01 |
| IUPAC Name | 1-(3H-1-benzothiophen-3-id-2-yl)isoquinoline;iridium;(Z)-4,4,4-trifluoro-3-hydroxy-1-thiophen-2-ylbut-2-en-1-one |
| SMILES | O=C(/C=C(\O)C(F)(F)F)c1cccs1.[Ir].[c-]1c(-c2nccc3ccccc23)sc2ccccc12 |
| InChI | InChI=1S/C17H10NS.C8H5F3O2S.Ir/c1-3-7-14-12(5-1)9-10-18-17(14)16-11-13-6-2-4-8-15(13)19-16;9-8(10,11)7(13)4-5(12)6-2-1-3-14-6;/h1-10H;1-4,13H;/q-1;;/b;7-4-; |
| InChIKey | YSNFVVYJILSEPF-XTXOHDESSA-N |
| XLogP | 7.85 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.75 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|