C26H28ClN3O5S — CID 162477331
2-(3-chlorophenyl)-1-[5-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-pyrrolidin-2-ylethanone (PubChem CID 162477331) has the molecular formula C26H28ClN3O5S and a molecular weight of 530.05 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1-[5-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-pyrrolidin-2-ylethanone.
| Compound Name | 2-(3-chlorophenyl)-1-[5-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-pyrrolidin-2-ylethanone |
|---|---|
| PubChem CID | 162477331 |
| Molecular Formula | C26H28ClN3O5S |
| Molecular Weight | 530.05 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | 2-(3-chlorophenyl)-1-[5-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-pyrrolidin-2-ylethanone |
| SMILES | O=C(C(c1cccc(Cl)c1)C1CCCN1)N1CC2=C(C1)CN(S(=O)(=O)c1ccc3c(c1)OCCO3)C2 |
| InChI | InChI=1S/C26H28ClN3O5S/c27-20-4-1-3-17(11-20)25(22-5-2-8-28-22)26(31)29-13-18-15-30(16-19(18)14-29)36(32,33)21-6-7-23-24(12-21)35-10-9-34-23/h1,3-4,6-7,11-12,22,25,28H,2,5,8-10,13-16H2 |
| InChIKey | NDUWZCIJLSJAON-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.05 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|