C29H32F2N4O6S — CID 146490538
2-[3-(9,9-difluoro-3,7-diazabicyclo[3.3.1]nonan-3-yl)phenyl]-1-[5-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-hydroxyethanone (PubChem CID 146490538) has the molecular formula C29H32F2N4O6S and a molecular weight of 602.66 g/mol. Its IUPAC name is 2-[3-(9,9-difluoro-3,7-diazabicyclo[3.3.1]nonan-3-yl)phenyl]-1-[5-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-hydroxyethanone.
| Compound Name | 2-[3-(9,9-difluoro-3,7-diazabicyclo[3.3.1]nonan-3-yl)phenyl]-1-[5-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 146490538 |
| Molecular Formula | C29H32F2N4O6S |
| Molecular Weight | 602.66 g/mol |
| Exact Mass | 602.20 |
| IUPAC Name | 2-[3-(9,9-difluoro-3,7-diazabicyclo[3.3.1]nonan-3-yl)phenyl]-1-[5-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-hydroxyethanone |
| SMILES | O=C(C(O)c1cccc(N2CC3CNCC(C2)C3(F)F)c1)N1CC2=C(C1)CN(S(=O)(=O)c1ccc3c(c1)OCCO3)C2 |
| InChI | InChI=1S/C29H32F2N4O6S/c30-29(31)21-10-32-11-22(29)17-33(16-21)23-3-1-2-18(8-23)27(36)28(37)34-12-19-14-35(15-20(19)13-34)42(38,39)24-4-5-25-26(9-24)41-7-6-40-25/h1-5,8-9,21-22,27,32,36H,6-7,10-17H2 |
| InChIKey | PRLDXEWIIYEAGA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.66 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|