C23H23F2N3O6S — CID 146530447
(2S)-1-[5-[4-(difluoromethoxy)phenyl]sulfonyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)-2-hydroxyethanone (PubChem CID 146530447) has the molecular formula C23H23F2N3O6S and a molecular weight of 507.52 g/mol. Its IUPAC name is (2S)-1-[5-[4-(difluoromethoxy)phenyl]sulfonyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)-2-hydroxyethanone.
| Compound Name | (2S)-1-[5-[4-(difluoromethoxy)phenyl]sulfonyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)-2-hydroxyethanone |
|---|---|
| PubChem CID | 146530447 |
| Molecular Formula | C23H23F2N3O6S |
| Molecular Weight | 507.52 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | (2S)-1-[5-[4-(difluoromethoxy)phenyl]sulfonyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)-2-hydroxyethanone |
| SMILES | O=C([C@@H](O)c1ccc2c(c1)NCCO2)N1CC2=C(C1)CN(S(=O)(=O)c1ccc(OC(F)F)cc1)C2 |
| InChI | InChI=1S/C23H23F2N3O6S/c24-23(25)34-17-2-4-18(5-3-17)35(31,32)28-12-15-10-27(11-16(15)13-28)22(30)21(29)14-1-6-20-19(9-14)26-7-8-33-20/h1-6,9,21,23,26,29H,7-8,10-13H2/t21-/m0/s1 |
| InChIKey | ZGGULHDLJRNHQR-NRFANRHFSA-N |
| XLogP | 1.97 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.52 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|