C24H25N3O5S — CID 163906465
[5-(3,4-dihydro-2H-1,4-benzoxazin-6-ylsulfonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-(2-hydroxy-1-phenylcyclopropyl)methanone (PubChem CID 163906465) has the molecular formula C24H25N3O5S and a molecular weight of 467.55 g/mol. Its IUPAC name is [5-(3,4-dihydro-2H-1,4-benzoxazin-6-ylsulfonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-(2-hydroxy-1-phenylcyclopropyl)methanone.
| Compound Name | [5-(3,4-dihydro-2H-1,4-benzoxazin-6-ylsulfonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-(2-hydroxy-1-phenylcyclopropyl)methanone |
|---|---|
| PubChem CID | 163906465 |
| Molecular Formula | C24H25N3O5S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | [5-(3,4-dihydro-2H-1,4-benzoxazin-6-ylsulfonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-(2-hydroxy-1-phenylcyclopropyl)methanone |
| SMILES | O=C(N1CC2=C(C1)CN(S(=O)(=O)c1ccc3c(c1)NCCO3)C2)C1(c2ccccc2)CC1O |
| InChI | InChI=1S/C24H25N3O5S/c28-22-11-24(22,18-4-2-1-3-5-18)23(29)26-12-16-14-27(15-17(16)13-26)33(30,31)19-6-7-21-20(10-19)25-8-9-32-21/h1-7,10,22,25,28H,8-9,11-15H2 |
| InChIKey | QOIJMXZKBYFJAI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|