C22H21BrN2O6S — CID 146490806
(2S)-2-(3-bromophenyl)-1-[5-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-hydroxyethanone (PubChem CID 146490806) has the molecular formula C22H21BrN2O6S and a molecular weight of 521.39 g/mol. Its IUPAC name is (2S)-2-(3-bromophenyl)-1-[5-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-hydroxyethanone.
| Compound Name | (2S)-2-(3-bromophenyl)-1-[5-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 146490806 |
| Molecular Formula | C22H21BrN2O6S |
| Molecular Weight | 521.39 g/mol |
| Exact Mass | 520.03 |
| IUPAC Name | (2S)-2-(3-bromophenyl)-1-[5-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-hydroxyethanone |
| SMILES | O=C([C@@H](O)c1cccc(Br)c1)N1CC2=C(C1)CN(S(=O)(=O)c1ccc3c(c1)OCCO3)C2 |
| InChI | InChI=1S/C22H21BrN2O6S/c23-17-3-1-2-14(8-17)21(26)22(27)24-10-15-12-25(13-16(15)11-24)32(28,29)18-4-5-19-20(9-18)31-7-6-30-19/h1-5,8-9,21,26H,6-7,10-13H2/t21-/m0/s1 |
| InChIKey | KLTMDIYOFBINRH-NRFANRHFSA-N |
| XLogP | 2.10 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.39 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|