C24H25F2N3O5S — CID 146530435
(2R)-1-[5-[4-(difluoromethoxy)phenyl]sulfonyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-hydroxy-2-(1,2,3,4-tetrahydroisoquinolin-7-yl)ethanone (PubChem CID 146530435) has the molecular formula C24H25F2N3O5S and a molecular weight of 505.54 g/mol. Its IUPAC name is (2R)-1-[5-[4-(difluoromethoxy)phenyl]sulfonyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-hydroxy-2-(1,2,3,4-tetrahydroisoquinolin-7-yl)ethanone.
| Compound Name | (2R)-1-[5-[4-(difluoromethoxy)phenyl]sulfonyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-hydroxy-2-(1,2,3,4-tetrahydroisoquinolin-7-yl)ethanone |
|---|---|
| PubChem CID | 146530435 |
| Molecular Formula | C24H25F2N3O5S |
| Molecular Weight | 505.54 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | (2R)-1-[5-[4-(difluoromethoxy)phenyl]sulfonyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-hydroxy-2-(1,2,3,4-tetrahydroisoquinolin-7-yl)ethanone |
| SMILES | O=C([C@H](O)c1ccc2c(c1)CNCC2)N1CC2=C(C1)CN(S(=O)(=O)c1ccc(OC(F)F)cc1)C2 |
| InChI | InChI=1S/C24H25F2N3O5S/c25-24(26)34-20-3-5-21(6-4-20)35(32,33)29-13-18-11-28(12-19(18)14-29)23(31)22(30)16-2-1-15-7-8-27-10-17(15)9-16/h1-6,9,22,24,27,30H,7-8,10-14H2/t22-/m1/s1 |
| InChIKey | LKBSJNJWZJXDNE-JOCHJYFZSA-N |
| XLogP | 1.81 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.54 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|