C53H52N2 — CID 162480060
N,N-bis(4-tert-butylphenyl)-6-(2,3,4,5,6-pentadeuteriophenyl)-9-[3-(2-phenylpropan-2-yl)phenyl]carbazol-3-amine (PubChem CID 162480060) has the molecular formula C53H52N2 and a molecular weight of 722.04 g/mol. Its IUPAC name is N,N-bis(4-tert-butylphenyl)-6-(2,3,4,5,6-pentadeuteriophenyl)-9-[3-(2-phenylpropan-2-yl)phenyl]carbazol-3-amine.
| Compound Name | N,N-bis(4-tert-butylphenyl)-6-(2,3,4,5,6-pentadeuteriophenyl)-9-[3-(2-phenylpropan-2-yl)phenyl]carbazol-3-amine |
|---|---|
| PubChem CID | 162480060 |
| Molecular Formula | C53H52N2 |
| Molecular Weight | 722.04 g/mol |
| Exact Mass | 721.44 |
| IUPAC Name | N,N-bis(4-tert-butylphenyl)-6-(2,3,4,5,6-pentadeuteriophenyl)-9-[3-(2-phenylpropan-2-yl)phenyl]carbazol-3-amine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3c(c2)c2cc(N(c4ccc(C(C)(C)C)cc4)c4ccc(C(C)(C)C)cc4)ccc2n3-c2cccc(C(C)(C)c3ccccc3)c2)c([2H])c1[2H] |
| InChI | InChI=1S/C53H52N2/c1-51(2,3)39-23-27-43(28-24-39)54(44-29-25-40(26-30-44)52(4,5)6)46-31-33-50-48(36-46)47-34-38(37-16-11-9-12-17-37)22-32-49(47)55(50)45-21-15-20-42(35-45)53(7,8)41-18-13-10-14-19-41/h9-36H,1-8H3/i9D,11D,12D,16D,17D |
| InChIKey | HRENBZXKBIVLHA-MDPSGQPWSA-N |
| XLogP | 14.84 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.04 |
| LogP ≤ 5 | 14.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |