C74H64N2Si2 — CID 164786983
N,N-bis(4-tert-butylphenyl)-6-(2,3,4,5,6-pentadeuteriophenyl)-9-[4-(5,10,10-triphenylsilanthren-5-yl)phenyl]carbazol-3-amine (PubChem CID 164786983) has the molecular formula C74H64N2Si2 and a molecular weight of 1042.54 g/mol. Its IUPAC name is N,N-bis(4-tert-butylphenyl)-6-(2,3,4,5,6-pentadeuteriophenyl)-9-[4-(5,10,10-triphenylsilanthren-5-yl)phenyl]carbazol-3-amine.
| Compound Name | N,N-bis(4-tert-butylphenyl)-6-(2,3,4,5,6-pentadeuteriophenyl)-9-[4-(5,10,10-triphenylsilanthren-5-yl)phenyl]carbazol-3-amine |
|---|---|
| PubChem CID | 164786983 |
| Molecular Formula | C74H64N2Si2 |
| Molecular Weight | 1042.54 g/mol |
| Exact Mass | 1041.49 |
| IUPAC Name | N,N-bis(4-tert-butylphenyl)-6-(2,3,4,5,6-pentadeuteriophenyl)-9-[4-(5,10,10-triphenylsilanthren-5-yl)phenyl]carbazol-3-amine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3c(c2)c2cc(N(c4ccc(C(C)(C)C)cc4)c4ccc(C(C)(C)C)cc4)ccc2n3-c2ccc([Si]3(c4ccccc4)c4ccccc4[Si](c4ccccc4)(c4ccccc4)c4ccccc43)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C74H64N2Si2/c1-73(2,3)55-36-40-57(41-37-55)75(58-42-38-56(39-43-58)74(4,5)6)60-46-50-68-66(52-60)65-51-54(53-23-11-7-12-24-53)35-49-67(65)76(68)59-44-47-64(48-45-59)78(63-29-17-10-18-30-63)71-33-21-19-31-69(71)77(61-25-13-8-14-26-61,62-27-15-9-16-28-62)70-32-20-22-34-72(70)78/h7-52H,1-6H3/i7D,11D,12D,23D,24D |
| InChIKey | VKLLTWRONTYSPD-QZCVAOHYSA-N |
| XLogP | 13.58 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1042.54 |
| LogP ≤ 5 | 13.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|