C52H33NS — CID 162481351
N-(2,3,5,6-tetradeuterio-4-dibenzothiophen-4-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-phenanthren-9-ylphenyl)phenanthren-9-amine (PubChem CID 162481351) has the molecular formula C52H33NS and a molecular weight of 711.96 g/mol. Its IUPAC name is N-(2,3,5,6-tetradeuterio-4-dibenzothiophen-4-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-phenanthren-9-ylphenyl)phenanthren-9-amine.
| Compound Name | N-(2,3,5,6-tetradeuterio-4-dibenzothiophen-4-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-phenanthren-9-ylphenyl)phenanthren-9-amine |
|---|---|
| PubChem CID | 162481351 |
| Molecular Formula | C52H33NS |
| Molecular Weight | 711.96 g/mol |
| Exact Mass | 711.28 |
| IUPAC Name | N-(2,3,5,6-tetradeuterio-4-dibenzothiophen-4-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-phenanthren-9-ylphenyl)phenanthren-9-amine |
| SMILES | [2H]c1c([2H])c(N(c2c([2H])c([2H])c(-c3cccc4c3sc3ccccc34)c([2H])c2[2H])c2cc3ccccc3c3ccccc23)c([2H])c([2H])c1-c1cc2ccccc2c2ccccc12 |
| InChI | InChI=1S/C52H33NS/c1-3-14-40-36(12-1)32-49(45-18-6-5-16-43(40)45)35-26-30-39(31-27-35)53(50-33-37-13-2-4-15-41(37)44-17-7-8-19-46(44)50)38-28-24-34(25-29-38)42-21-11-22-48-47-20-9-10-23-51(47)54-52(42)48/h1-33H/i24D,25D,26D,27D,28D,29D,30D,31D |
| InChIKey | ASFSFYVOPLSYPW-XMTJRKPZSA-N |
| XLogP | 15.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.96 |
| LogP ≤ 5 | 15.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|