C17H16FN5O3 — CID 162488565
(2-fluorophenyl)methyl (2S)-2-(7H-purin-8-yl)morpholine-4-carboxylate (PubChem CID 162488565) has the molecular formula C17H16FN5O3 and a molecular weight of 357.35 g/mol. Its IUPAC name is (2-fluorophenyl)methyl (2S)-2-(7H-purin-8-yl)morpholine-4-carboxylate.
| Compound Name | (2-fluorophenyl)methyl (2S)-2-(7H-purin-8-yl)morpholine-4-carboxylate |
|---|---|
| PubChem CID | 162488565 |
| Molecular Formula | C17H16FN5O3 |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | (2-fluorophenyl)methyl (2S)-2-(7H-purin-8-yl)morpholine-4-carboxylate |
| SMILES | O=C(OCc1ccccc1F)N1CCO[C@H](c2nc3ncncc3[nH]2)C1 |
| InChI | InChI=1S/C17H16FN5O3/c18-12-4-2-1-3-11(12)9-26-17(24)23-5-6-25-14(8-23)16-21-13-7-19-10-20-15(13)22-16/h1-4,7,10,14H,5-6,8-9H2,(H,19,20,21,22)/t14-/m0/s1 |
| InChIKey | VLNITFBUNSJODX-AWEZNQCLSA-N |
| XLogP | 2.20 |
| TPSA | 93.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |