C24H31N7OS2 — CID 162492600
5-(1-ethylpyrazol-4-yl)-2-[5-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]pyridin-3-ol (PubChem CID 162492600) has the molecular formula C24H31N7OS2 and a molecular weight of 497.69 g/mol. Its IUPAC name is 5-(1-ethylpyrazol-4-yl)-2-[5-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]pyridin-3-ol.
| Compound Name | 5-(1-ethylpyrazol-4-yl)-2-[5-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]pyridin-3-ol |
|---|---|
| PubChem CID | 162492600 |
| Molecular Formula | C24H31N7OS2 |
| Molecular Weight | 497.69 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | 5-(1-ethylpyrazol-4-yl)-2-[5-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]pyridin-3-ol |
| SMILES | CCn1cc(-c2cnc(-c3nc4sc(N(C)C5CC(C)(C)NC(C)(C)C5)nc4s3)c(O)c2)cn1 |
| InChI | InChI=1S/C24H31N7OS2/c1-7-31-13-15(12-26-31)14-8-17(32)18(25-11-14)19-27-20-21(33-19)28-22(34-20)30(6)16-9-23(2,3)29-24(4,5)10-16/h8,11-13,16,29,32H,7,9-10H2,1-6H3 |
| InChIKey | LYBLBGXFNNBCPI-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.69 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |