C19H26F12O4PPd+ — CID 162495192
bis((Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one);palladium;tri(propan-2-yl)phosphanium (PubChem CID 162495192) has the molecular formula C19H26F12O4PPd+ and a molecular weight of 683.78 g/mol. Its IUPAC name is bis((Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one);palladium;tri(propan-2-yl)phosphanium.
| Compound Name | bis((Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one);palladium;tri(propan-2-yl)phosphanium |
|---|---|
| PubChem CID | 162495192 |
| Molecular Formula | C19H26F12O4PPd+ |
| Molecular Weight | 683.78 g/mol |
| Exact Mass | 683.04 |
| IUPAC Name | bis((Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one);palladium;tri(propan-2-yl)phosphanium |
| SMILES | CC(C)[PH+](C(C)C)C(C)C.O=C(/C=C(\O)C(F)(F)F)C(F)(F)F.O=C(/C=C(\O)C(F)(F)F)C(F)(F)F.[Pd] |
| InChI | InChI=1S/C9H21P.2C5H2F6O2.Pd/c1-7(2)10(8(3)4)9(5)6;2*6-4(7,8)2(12)1-3(13)5(9,10)11;/h7-9H,1-6H3;2*1,12H;/p+1/b;2*2-1-; |
| InChIKey | YRLSVGRBWLXIEF-VIBDZMCESA-O |
| XLogP | 7.67 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.78 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|