C24H21N3O4S — CID 162495903
2-[[4-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]phenyl]sulfonylamino]benzoic acid (PubChem CID 162495903) has the molecular formula C24H21N3O4S and a molecular weight of 447.52 g/mol. Its IUPAC name is 2-[[4-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]phenyl]sulfonylamino]benzoic acid.
| Compound Name | 2-[[4-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]phenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 162495903 |
| Molecular Formula | C24H21N3O4S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 2-[[4-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]phenyl]sulfonylamino]benzoic acid |
| SMILES | Cc1ccccc1Cn1cc(-c2ccc(S(=O)(=O)Nc3ccccc3C(=O)O)cc2)cn1 |
| InChI | InChI=1S/C24H21N3O4S/c1-17-6-2-3-7-19(17)15-27-16-20(14-25-27)18-10-12-21(13-11-18)32(30,31)26-23-9-5-4-8-22(23)24(28)29/h2-14,16,26H,15H2,1H3,(H,28,29) |
| InChIKey | DBQZIAKNDMKMQQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |