C21H25ClIrNO3 — CID 162497305
carbanide;chloroiridium(2+);7-(2-methoxyethoxy)-N-(4-methoxyphenyl)-2,3,4,8-tetrahydronaphthalen-8-id-1-imine (PubChem CID 162497305) has the molecular formula C21H25ClIrNO3 and a molecular weight of 567.11 g/mol. Its IUPAC name is carbanide;chloroiridium(2+);7-(2-methoxyethoxy)-N-(4-methoxyphenyl)-2,3,4,8-tetrahydronaphthalen-8-id-1-imine.
| Compound Name | carbanide;chloroiridium(2+);7-(2-methoxyethoxy)-N-(4-methoxyphenyl)-2,3,4,8-tetrahydronaphthalen-8-id-1-imine |
|---|---|
| PubChem CID | 162497305 |
| Molecular Formula | C21H25ClIrNO3 |
| Molecular Weight | 567.11 g/mol |
| Exact Mass | 567.12 |
| IUPAC Name | carbanide;chloroiridium(2+);7-(2-methoxyethoxy)-N-(4-methoxyphenyl)-2,3,4,8-tetrahydronaphthalen-8-id-1-imine |
| SMILES | COCCOc1[c-]c2c(cc1)CCC/C2=N\c1ccc(OC)cc1.Cl[Ir+2].[CH3-] |
| InChI | InChI=1S/C20H22NO3.CH3.ClH.Ir/c1-22-12-13-24-18-9-6-15-4-3-5-20(19(15)14-18)21-16-7-10-17(23-2)11-8-16;;;/h6-11H,3-5,12-13H2,1-2H3;1H3;1H;/q2*-1;;+3/p-1/b21-20+;;; |
| InChIKey | RDXNCOFMUDLZDP-BFUOAJNWSA-M |
| XLogP | 5.11 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.11 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|