C29H33NO3 — CID 164724177
N-(4-methoxyphenyl)-7-[(1R)-2-methoxy-1-phenylethoxy]-8-propan-2-yl-3,4-dihydro-2H-naphthalen-1-imine (PubChem CID 164724177) has the molecular formula C29H33NO3 and a molecular weight of 443.59 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-7-[(1R)-2-methoxy-1-phenylethoxy]-8-propan-2-yl-3,4-dihydro-2H-naphthalen-1-imine.
| Compound Name | N-(4-methoxyphenyl)-7-[(1R)-2-methoxy-1-phenylethoxy]-8-propan-2-yl-3,4-dihydro-2H-naphthalen-1-imine |
|---|---|
| PubChem CID | 164724177 |
| Molecular Formula | C29H33NO3 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | N-(4-methoxyphenyl)-7-[(1R)-2-methoxy-1-phenylethoxy]-8-propan-2-yl-3,4-dihydro-2H-naphthalen-1-imine |
| SMILES | COC[C@H](Oc1ccc2c(c1C(C)C)/C(=N/c1ccc(OC)cc1)CCC2)c1ccccc1 |
| InChI | InChI=1S/C29H33NO3/c1-20(2)28-26(33-27(19-31-3)21-9-6-5-7-10-21)18-13-22-11-8-12-25(29(22)28)30-23-14-16-24(32-4)17-15-23/h5-7,9-10,13-18,20,27H,8,11-12,19H2,1-4H3/b30-25+/t27-/m0/s1 |
| InChIKey | MDBXZXFLSMIWRW-LLDNVPTHSA-N |
| XLogP | 7.04 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|