C17H22S — CID 162498933
9-tert-butyl-2,3,4,9-tetrahydro-1H-thioxanthene (PubChem CID 162498933) has the molecular formula C17H22S and a molecular weight of 258.43 g/mol. Its IUPAC name is 9-tert-butyl-2,3,4,9-tetrahydro-1H-thioxanthene.
| Compound Name | 9-tert-butyl-2,3,4,9-tetrahydro-1H-thioxanthene |
|---|---|
| PubChem CID | 162498933 |
| Molecular Formula | C17H22S |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 9-tert-butyl-2,3,4,9-tetrahydro-1H-thioxanthene |
| SMILES | CC(C)(C)C1C2=C(CCCC2)Sc2ccccc21 |
| InChI | InChI=1S/C17H22S/c1-17(2,3)16-12-8-4-6-10-14(12)18-15-11-7-5-9-13(15)16/h4,6,8,10,16H,5,7,9,11H2,1-3H3 |
| InChIKey | ZMIWGTJGUKCKFZ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |