C54H43B2N2O2PtS2- — CID 162499221
[2,3-bis(4-dibenzothiophen-4-ylphenyl)-4-phenyl-1-phenyl-1,4,2,3-diazadiborolidin-5-ylidene]platinum;pentane-2,4-diol (PubChem CID 162499221) has the molecular formula C54H43B2N2O2PtS2- and a molecular weight of 1032.79 g/mol. Its IUPAC name is [2,3-bis(4-dibenzothiophen-4-ylphenyl)-4-phenyl-1-phenyl-1,4,2,3-diazadiborolidin-5-ylidene]platinum;pentane-2,4-diol.
| Compound Name | [2,3-bis(4-dibenzothiophen-4-ylphenyl)-4-phenyl-1-phenyl-1,4,2,3-diazadiborolidin-5-ylidene]platinum;pentane-2,4-diol |
|---|---|
| PubChem CID | 162499221 |
| Molecular Formula | C54H43B2N2O2PtS2- |
| Molecular Weight | 1032.79 g/mol |
| Exact Mass | 1032.26 |
| IUPAC Name | [2,3-bis(4-dibenzothiophen-4-ylphenyl)-4-phenyl-1-phenyl-1,4,2,3-diazadiborolidin-5-ylidene]platinum;pentane-2,4-diol |
| SMILES | CC(O)CC(C)O.[Pt]=C1N(c2[c-]cccc2)B(c2ccc(-c3cccc4c3sc3ccccc34)cc2)B(c2ccc(-c3cccc4c3sc3ccccc34)cc2)N1c1ccccc1 |
| InChI | InChI=1S/C49H31B2N2S2.C5H12O2.Pt/c1-3-13-38(14-4-1)52-33-53(39-15-5-2-6-16-39)51(37-31-27-35(28-32-37)41-20-12-22-45-43-18-8-10-24-47(43)55-49(41)45)50(52)36-29-25-34(26-30-36)40-19-11-21-44-42-17-7-9-23-46(42)54-48(40)44;1-4(6)3-5(2)7;/h1-15,17-32H;4-7H,3H2,1-2H3;/q-1;; |
| InChIKey | UGQTVOUAFOXUME-UHFFFAOYSA-N |
| XLogP | 11.53 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1032.79 |
| LogP ≤ 5 | 11.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|