C25H26N6O2 — CID 162502525
7-[6-isocyano-3-[1-(3-methoxy-3-methylbutyl)pyrazol-4-yl]-5-methyl-2-pyridinyl]-3-methoxycinnoline (PubChem CID 162502525) has the molecular formula C25H26N6O2 and a molecular weight of 442.52 g/mol. Its IUPAC name is 7-[6-isocyano-3-[1-(3-methoxy-3-methylbutyl)pyrazol-4-yl]-5-methyl-2-pyridinyl]-3-methoxycinnoline.
| Compound Name | 7-[6-isocyano-3-[1-(3-methoxy-3-methylbutyl)pyrazol-4-yl]-5-methyl-2-pyridinyl]-3-methoxycinnoline |
|---|---|
| PubChem CID | 162502525 |
| Molecular Formula | C25H26N6O2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 7-[6-isocyano-3-[1-(3-methoxy-3-methylbutyl)pyrazol-4-yl]-5-methyl-2-pyridinyl]-3-methoxycinnoline |
| SMILES | [C-]#[N+]c1nc(-c2ccc3cc(OC)nnc3c2)c(-c2cnn(CCC(C)(C)OC)c2)cc1C |
| InChI | InChI=1S/C25H26N6O2/c1-16-11-20(19-14-27-31(15-19)10-9-25(2,3)33-6)23(28-24(16)26-4)18-8-7-17-13-22(32-5)30-29-21(17)12-18/h7-8,11-15H,9-10H2,1-3,5-6H3 |
| InChIKey | NJNNYFJHPYYQQO-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 79.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|