C22H29N3O3 — CID 162504339
3-[5-(3-tert-butylpiperidin-1-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 162504339) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is 3-[5-(3-tert-butylpiperidin-1-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-(3-tert-butylpiperidin-1-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 162504339 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 3-[5-(3-tert-butylpiperidin-1-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC(C)(C)C1CCCN(c2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3)C1 |
| InChI | InChI=1S/C22H29N3O3/c1-22(2,3)15-5-4-10-24(13-15)16-7-6-14-12-25(21(28)17(14)11-16)18-8-9-19(26)23-20(18)27/h6-7,11,15,18H,4-5,8-10,12-13H2,1-3H3,(H,23,26,27) |
| InChIKey | GSTNTEFXBLCCBK-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|