C19H21F2N3O4 — CID 170384962
3-[5-[3,3-difluoro-4-(hydroxymethyl)piperidin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 170384962) has the molecular formula C19H21F2N3O4 and a molecular weight of 393.39 g/mol. Its IUPAC name is 3-[5-[3,3-difluoro-4-(hydroxymethyl)piperidin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[3,3-difluoro-4-(hydroxymethyl)piperidin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170384962 |
| Molecular Formula | C19H21F2N3O4 |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 3-[5-[3,3-difluoro-4-(hydroxymethyl)piperidin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3ccc(N4CCC(CO)C(F)(F)C4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C19H21F2N3O4/c20-19(21)10-23(6-5-12(19)9-25)13-2-1-11-8-24(18(28)14(11)7-13)15-3-4-16(26)22-17(15)27/h1-2,7,12,15,25H,3-6,8-10H2,(H,22,26,27) |
| InChIKey | XFSODNNPLHTHFG-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|