C26H28FN3O6S — CID 176892116
[(3R,4R)-1-[2-[(3R)-2,6-dioxopiperidin-3-yl]-3-oxo-1H-isoindol-5-yl]-3-fluoropiperidin-4-yl]-(3-methylphenyl)methanesulfonic acid (PubChem CID 176892116) has the molecular formula C26H28FN3O6S and a molecular weight of 529.59 g/mol. Its IUPAC name is [(3R,4R)-1-[2-[(3R)-2,6-dioxopiperidin-3-yl]-3-oxo-1H-isoindol-5-yl]-3-fluoropiperidin-4-yl]-(3-methylphenyl)methanesulfonic acid.
| Compound Name | [(3R,4R)-1-[2-[(3R)-2,6-dioxopiperidin-3-yl]-3-oxo-1H-isoindol-5-yl]-3-fluoropiperidin-4-yl]-(3-methylphenyl)methanesulfonic acid |
|---|---|
| PubChem CID | 176892116 |
| Molecular Formula | C26H28FN3O6S |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.17 |
| IUPAC Name | [(3R,4R)-1-[2-[(3R)-2,6-dioxopiperidin-3-yl]-3-oxo-1H-isoindol-5-yl]-3-fluoropiperidin-4-yl]-(3-methylphenyl)methanesulfonic acid |
| SMILES | Cc1cccc(C([C@@H]2CCN(c3ccc4c(c3)C(=O)N([C@@H]3CCC(=O)NC3=O)C4)C[C@@H]2F)S(=O)(=O)O)c1 |
| InChI | InChI=1S/C26H28FN3O6S/c1-15-3-2-4-16(11-15)24(37(34,35)36)19-9-10-29(14-21(19)27)18-6-5-17-13-30(26(33)20(17)12-18)22-7-8-23(31)28-25(22)32/h2-6,11-12,19,21-22,24H,7-10,13-14H2,1H3,(H,28,31,32)(H,34,35,36)/t19-,21+,22-,24?/m1/s1 |
| InChIKey | HVWKSGVAYABHFX-AAWHNNQASA-N |
| XLogP | 2.55 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|