C21H25N3O5 — CID 162504422
4-(2-tert-butylmorpholin-4-yl)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 162504422) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is 4-(2-tert-butylmorpholin-4-yl)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-(2-tert-butylmorpholin-4-yl)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 162504422 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 4-(2-tert-butylmorpholin-4-yl)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | CC(C)(C)C1CN(c2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)CCO1 |
| InChI | InChI=1S/C21H25N3O5/c1-21(2,3)15-11-23(9-10-29-15)13-6-4-5-12-17(13)20(28)24(19(12)27)14-7-8-16(25)22-18(14)26/h4-6,14-15H,7-11H2,1-3H3,(H,22,25,26) |
| InChIKey | UNTQKAVWRQNMLT-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|